kailanesantos476 kailanesantos476

22-10-2022
World Languages

contestada

2. No primeiro balão, há dois verbos, será e feito. O que permite identificá-los com 3. Observe o uso da palavra feito na frase "Quando Calvin for homem feito pens

Respuesta :

Otras preguntas

What is the sum of -2/3 and -4/6? i just want the answer A. -4/3 B. -2/3 C. 2/3 D. 4/3

The _____ model of justice argues that most important function of the criminal justice system is to suppress and control criminal behavior as a function of publ

A box contains 10 green marbles and 11 white marbles. If the first marble chosen was a green marble, what is the probability of choosing, without replacement,

In paragraph 46, the point of view changes from third-person to first-person narration. What is the purpose of this shift in point of view?

How can an author's language evoke a sense of time and place? A. by explictly naming a specific place and time B. through the use of careful diction and sentenc

What is the monument of a 1200 kg truck traveling at a speed of 25 m/s?

Inventory records help determine how many items of material, components, and subassemblies need to be ordered to make the final product. True or False True Fals

which conversion is the function of a photovoltaic cell? A) sunlight to electricity B) sunlight to mechanical energy C) sunlight into heat D) electricty into he

The legislative branch ________________________. was created out of the "Great Compromise includes the House of Representative includes the Senate all of the ab

PbS(s)+4H2O2(aq)→PbSO4(s)+4H2O(l)PbS(s)+4H2O2(aq)→PbSO4(s)+4H2O(l) Express your answers as chemical symbols separated by a comma. Enter the oxidized element fir