chijiokeazu1 chijiokeazu1

25-01-2024
Mathematics

contestada

cos(x+pi/6)-cos(x-pi/6)=1
How do I solve this by using the sum and difference formulas?

Respuesta :

Otras preguntas

Please help and thank you

Please help on this question

Rodney just earned his master’s degree in Marketing. Based on his education, which job would he be best suited for? Supply Chain Manager Survey Researcher Logi

Given that (5,6) is on the graph of f(x), find the corresponding point for the function 4f(x)

What is social mobility? A. movement of people from one society to another B. movement of people within the social structures of a stratified society C. tran

Write an equation for that graph,where y depends on x. ____

Why do humans flinch when they think they’re going to be hit or something is coming at them?

For a proof by induction of the math statement below, identify the correct step for proving the theorem is true for n = k + 1. 1+3+5...+(2n-1)=n^2

While doing research for a paper on teenage rebellion

What are the coefficients required to balance the chemical equation?