MySo0leSa9nielMoniki MySo0leSa9nielMoniki

22-07-2016
Chemistry

contestada

A carbon molecule that has a different arrangement of atoms is known as a/an
a. isomer.
b. nucleotide.
c. peptide.
d. monomer.

Respuesta :

mpanderla95 mpanderla95

23-07-2016

The correct response I believe is A. Isomer. If a carbon molecule possess more than one arrangement of how its atoms can be arranged, those other arrangements are known as isomers.

Answer Link

Otras preguntas

mothertrucker dude i need help with %

Question Use the distance formula to find the distance between the points (1, -7) and (9,6). (Write your answer in exact form.) Provide your answer below: FEEDB

Y = -5/3 +3 and Y = 1/3x -3

What is the equation of the graph?

The electrostatic force between two small charged particles is 5.2 x 10^-7 N at a distance of 2 meters. What will be the new force if the distance is increased

rational or irrational?

Tanya coasted down the sidewalk on her bike at a constant speed of 15 meters per second for 20 seconds. The distance she traveled was: a. 0.75 m b. 1.3 m c. 35

Find the value of the angle

The activation energy for the gas phase isomerization of dimethyl citraconate is 105 kJ. cis-(CH3OOC)(CH3)C=CHCOOCH3trans-(CH3OOC)(CH3)C=CHCOOCH3 The rate const

Please solve 15x+1=10+2x