cedildy07stu cedildy07stu

23-02-2021
Chemistry

contestada

Why is there a border between light and dark on the moon

Respuesta :

Skylataneeweeks Skylataneeweeks

23-02-2021

Answer:

because the sun illuminates the half of the moon that's facing it leaving the other half dark

Answer Link

Otras preguntas

Which section of the pre-mrna contains the protein-coding regions? the pre-mrna doesnot code for proteins at all. introns the entire pre-mrna contains protein-c

An electron is accelerated from rest through a potential difference of 240 v. what is the de broglie wavelength of the electron?

FV Stutter: Why is this ____?

Which skeletal structure corresponds to the condensed structure ch2(oh)ch2chchco2ch(ch3)2?

What is the power of the eye in d when viewing an object 51.0 cm away? (assume the lens-to-retina distance is 2.00 cm.

Recall the definition of the ReviewVocabulary term of mass

Which social network functionality allows users to view a list of updates from friends as well as advertizements and notifications in chronological order?

At what temperature is the same numerical value obtained in celsius and fahrenheit?

Tement best explains how farming affected the economic slowdown that led to the great depression?

How might consumers use heuristics when choosing television shows to watch on netflix?